C16H25N3O2 — CID 77050574
4-[2-[(2,3-dimethylcyclopentyl)amino]ethoxy]-N'-hydroxybenzenecarboximidamide (PubChem CID 77050574) has the molecular formula C16H25N3O2 and a molecular weight of 291.39 g/mol. Its IUPAC name is 4-[2-[(2,3-dimethylcyclopentyl)amino]ethoxy]-N'-hydroxybenzenecarboximidamide.
| Compound Name | 4-[2-[(2,3-dimethylcyclopentyl)amino]ethoxy]-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 77050574 |
| Molecular Formula | C16H25N3O2 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.19 |
| IUPAC Name | 4-[2-[(2,3-dimethylcyclopentyl)amino]ethoxy]-N'-hydroxybenzenecarboximidamide |
| SMILES | CC1CCC(NCCOc2ccc(C(N)=NO)cc2)C1C |
| InChI | InChI=1S/C16H25N3O2/c1-11-3-8-15(12(11)2)18-9-10-21-14-6-4-13(5-7-14)16(17)19-20/h4-7,11-12,15,18,20H,3,8-10H2,1-2H3,(H2,17,19) |
| InChIKey | LWZRPDLRTQPCEJ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 79.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|