C8H15N5O2 — CID 77027890
N'-hydroxy-2-methyl-3-[(3-methyl-1,2,4-oxadiazol-5-yl)methylamino]propanimidamide (PubChem CID 77027890) has the molecular formula C8H15N5O2 and a molecular weight of 213.24 g/mol. Its IUPAC name is N'-hydroxy-2-methyl-3-[(3-methyl-1,2,4-oxadiazol-5-yl)methylamino]propanimidamide.
| Compound Name | N'-hydroxy-2-methyl-3-[(3-methyl-1,2,4-oxadiazol-5-yl)methylamino]propanimidamide |
|---|---|
| PubChem CID | 77027890 |
| Molecular Formula | C8H15N5O2 |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.12 |
| IUPAC Name | N'-hydroxy-2-methyl-3-[(3-methyl-1,2,4-oxadiazol-5-yl)methylamino]propanimidamide |
| SMILES | Cc1noc(CNCC(C)C(N)=NO)n1 |
| InChI | InChI=1S/C8H15N5O2/c1-5(8(9)12-14)3-10-4-7-11-6(2)13-15-7/h5,10,14H,3-4H2,1-2H3,(H2,9,12) |
| InChIKey | RYXCNXJFLPHZAX-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 109.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|