C13H19FN4O2 — CID 77027983
2-[[4-fluoro-2-(N'-hydroxycarbamimidoyl)phenyl]methylamino]-N-propylacetamide (PubChem CID 77027983) has the molecular formula C13H19FN4O2 and a molecular weight of 282.32 g/mol. Its IUPAC name is 2-[[4-fluoro-2-(N'-hydroxycarbamimidoyl)phenyl]methylamino]-N-propylacetamide.
| Compound Name | 2-[[4-fluoro-2-(N'-hydroxycarbamimidoyl)phenyl]methylamino]-N-propylacetamide |
|---|---|
| PubChem CID | 77027983 |
| Molecular Formula | C13H19FN4O2 |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 2-[[4-fluoro-2-(N'-hydroxycarbamimidoyl)phenyl]methylamino]-N-propylacetamide |
| SMILES | CCCNC(=O)CNCc1ccc(F)cc1C(N)=NO |
| InChI | InChI=1S/C13H19FN4O2/c1-2-5-17-12(19)8-16-7-9-3-4-10(14)6-11(9)13(15)18-20/h3-4,6,16,20H,2,5,7-8H2,1H3,(H2,15,18)(H,17,19) |
| InChIKey | BUNWTGSXWZSCSH-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 99.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|