C13H17FN6O — CID 77028697
5-fluoro-N'-hydroxy-2-[[2-(4-methyl-1,2,4-triazol-3-yl)ethylamino]methyl]benzenecarboximidamide (PubChem CID 77028697) has the molecular formula C13H17FN6O and a molecular weight of 292.32 g/mol. Its IUPAC name is 5-fluoro-N'-hydroxy-2-[[2-(4-methyl-1,2,4-triazol-3-yl)ethylamino]methyl]benzenecarboximidamide.
| Compound Name | 5-fluoro-N'-hydroxy-2-[[2-(4-methyl-1,2,4-triazol-3-yl)ethylamino]methyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 77028697 |
| Molecular Formula | C13H17FN6O |
| Molecular Weight | 292.32 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | 5-fluoro-N'-hydroxy-2-[[2-(4-methyl-1,2,4-triazol-3-yl)ethylamino]methyl]benzenecarboximidamide |
| SMILES | Cn1cnnc1CCNCc1ccc(F)cc1C(N)=NO |
| InChI | InChI=1S/C13H17FN6O/c1-20-8-17-18-12(20)4-5-16-7-9-2-3-10(14)6-11(9)13(15)19-21/h2-3,6,8,16,21H,4-5,7H2,1H3,(H2,15,19) |
| InChIKey | ALWZOFXGSBNVSL-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 101.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.32 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|