C7H16N4O2 — CID 77031758
2-[(1-amino-1-hydroxyiminopropan-2-yl)amino]-N-methylpropanamide (PubChem CID 77031758) has the molecular formula C7H16N4O2 and a molecular weight of 188.23 g/mol. Its IUPAC name is 2-[(1-amino-1-hydroxyiminopropan-2-yl)amino]-N-methylpropanamide.
| Compound Name | 2-[(1-amino-1-hydroxyiminopropan-2-yl)amino]-N-methylpropanamide |
|---|---|
| PubChem CID | 77031758 |
| Molecular Formula | C7H16N4O2 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 2-[(1-amino-1-hydroxyiminopropan-2-yl)amino]-N-methylpropanamide |
| SMILES | CNC(=O)C(C)NC(C)C(N)=NO |
| InChI | InChI=1S/C7H16N4O2/c1-4(6(8)11-13)10-5(2)7(12)9-3/h4-5,10,13H,1-3H3,(H2,8,11)(H,9,12) |
| InChIKey | XIDLDBUWYQFARR-UHFFFAOYSA-N |
| XLogP | -1.15 |
| TPSA | 99.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|