C13H10Cl2N2O3S — CID 77034071
3-[5-[[(4,5-dichloro-1H-pyrrole-2-carbonyl)amino]methyl]thiophen-2-yl]prop-2-enoic acid (PubChem CID 77034071) has the molecular formula C13H10Cl2N2O3S and a molecular weight of 345.21 g/mol. Its IUPAC name is 3-[5-[[(4,5-dichloro-1H-pyrrole-2-carbonyl)amino]methyl]thiophen-2-yl]prop-2-enoic acid.
| Compound Name | 3-[5-[[(4,5-dichloro-1H-pyrrole-2-carbonyl)amino]methyl]thiophen-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 77034071 |
| Molecular Formula | C13H10Cl2N2O3S |
| Molecular Weight | 345.21 g/mol |
| Exact Mass | 343.98 |
| IUPAC Name | 3-[5-[[(4,5-dichloro-1H-pyrrole-2-carbonyl)amino]methyl]thiophen-2-yl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1ccc(CNC(=O)c2cc(Cl)c(Cl)[nH]2)s1 |
| InChI | InChI=1S/C13H10Cl2N2O3S/c14-9-5-10(17-12(9)15)13(20)16-6-8-2-1-7(21-8)3-4-11(18)19/h1-5,17H,6H2,(H,16,20)(H,18,19) |
| InChIKey | KGVASCNPHCXBOE-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.21 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|