C13H11NO4S — CID 77033663
3-[5-[(furan-2-carbonylamino)methyl]thiophen-2-yl]prop-2-enoic acid (PubChem CID 77033663) has the molecular formula C13H11NO4S and a molecular weight of 277.30 g/mol. Its IUPAC name is 3-[5-[(furan-2-carbonylamino)methyl]thiophen-2-yl]prop-2-enoic acid.
| Compound Name | 3-[5-[(furan-2-carbonylamino)methyl]thiophen-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 77033663 |
| Molecular Formula | C13H11NO4S |
| Molecular Weight | 277.30 g/mol |
| Exact Mass | 277.04 |
| IUPAC Name | 3-[5-[(furan-2-carbonylamino)methyl]thiophen-2-yl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1ccc(CNC(=O)c2ccco2)s1 |
| InChI | InChI=1S/C13H11NO4S/c15-12(16)6-5-9-3-4-10(19-9)8-14-13(17)11-2-1-7-18-11/h1-7H,8H2,(H,14,17)(H,15,16) |
| InChIKey | QVXGCEXQUGAVOY-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.30 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|