C13H10ClNO4S — CID 106689553
(E)-3-[5-[[(2-chlorofuran-3-carbonyl)amino]methyl]thiophen-2-yl]prop-2-enoic acid (PubChem CID 106689553) has the molecular formula C13H10ClNO4S and a molecular weight of 311.75 g/mol. Its IUPAC name is (E)-3-[5-[[(2-chlorofuran-3-carbonyl)amino]methyl]thiophen-2-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[5-[[(2-chlorofuran-3-carbonyl)amino]methyl]thiophen-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 106689553 |
| Molecular Formula | C13H10ClNO4S |
| Molecular Weight | 311.75 g/mol |
| Exact Mass | 311.00 |
| IUPAC Name | (E)-3-[5-[[(2-chlorofuran-3-carbonyl)amino]methyl]thiophen-2-yl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccc(CNC(=O)c2ccoc2Cl)s1 |
| InChI | InChI=1S/C13H10ClNO4S/c14-12-10(5-6-19-12)13(18)15-7-9-2-1-8(20-9)3-4-11(16)17/h1-6H,7H2,(H,15,18)(H,16,17)/b4-3+ |
| InChIKey | GJRHLAVVLVCSHA-ONEGZZNKSA-N |
| XLogP | 3.02 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.75 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|