C12H23N3O4 — CID 77035784
4-(N'-hydroxycarbamimidoyl)-N-(1-methoxybutan-2-yl)oxane-4-carboxamide (PubChem CID 77035784) has the molecular formula C12H23N3O4 and a molecular weight of 273.33 g/mol. Its IUPAC name is 4-(N'-hydroxycarbamimidoyl)-N-(1-methoxybutan-2-yl)oxane-4-carboxamide.
| Compound Name | 4-(N'-hydroxycarbamimidoyl)-N-(1-methoxybutan-2-yl)oxane-4-carboxamide |
|---|---|
| PubChem CID | 77035784 |
| Molecular Formula | C12H23N3O4 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | 4-(N'-hydroxycarbamimidoyl)-N-(1-methoxybutan-2-yl)oxane-4-carboxamide |
| SMILES | CCC(COC)NC(=O)C1(C(N)=NO)CCOCC1 |
| InChI | InChI=1S/C12H23N3O4/c1-3-9(8-18-2)14-11(16)12(10(13)15-17)4-6-19-7-5-12/h9,17H,3-8H2,1-2H3,(H2,13,15)(H,14,16) |
| InChIKey | NMSMWWWIJBSVPD-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 106.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|