C8H13N5O3S — CID 77036319
N'-hydroxy-1-(1H-imidazol-5-ylsulfonyl)pyrrolidine-2-carboximidamide (PubChem CID 77036319) has the molecular formula C8H13N5O3S and a molecular weight of 259.29 g/mol. Its IUPAC name is N'-hydroxy-1-(1H-imidazol-5-ylsulfonyl)pyrrolidine-2-carboximidamide.
| Compound Name | N'-hydroxy-1-(1H-imidazol-5-ylsulfonyl)pyrrolidine-2-carboximidamide |
|---|---|
| PubChem CID | 77036319 |
| Molecular Formula | C8H13N5O3S |
| Molecular Weight | 259.29 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | N'-hydroxy-1-(1H-imidazol-5-ylsulfonyl)pyrrolidine-2-carboximidamide |
| SMILES | NC(=NO)C1CCCN1S(=O)(=O)c1cnc[nH]1 |
| InChI | InChI=1S/C8H13N5O3S/c9-8(12-14)6-2-1-3-13(6)17(15,16)7-4-10-5-11-7/h4-6,14H,1-3H2,(H2,9,12)(H,10,11) |
| InChIKey | CASRWDPOAUGJAA-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 124.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.29 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|