C11H16BrN3O3S — CID 77036740
5-[(3-bromophenyl)sulfonylamino]-N'-hydroxypentanimidamide (PubChem CID 77036740) has the molecular formula C11H16BrN3O3S and a molecular weight of 350.24 g/mol. Its IUPAC name is 5-[(3-bromophenyl)sulfonylamino]-N'-hydroxypentanimidamide.
| Compound Name | 5-[(3-bromophenyl)sulfonylamino]-N'-hydroxypentanimidamide |
|---|---|
| PubChem CID | 77036740 |
| Molecular Formula | C11H16BrN3O3S |
| Molecular Weight | 350.24 g/mol |
| Exact Mass | 349.01 |
| IUPAC Name | 5-[(3-bromophenyl)sulfonylamino]-N'-hydroxypentanimidamide |
| SMILES | NC(CCCCNS(=O)(=O)c1cccc(Br)c1)=NO |
| InChI | InChI=1S/C11H16BrN3O3S/c12-9-4-3-5-10(8-9)19(17,18)14-7-2-1-6-11(13)15-16/h3-5,8,14,16H,1-2,6-7H2,(H2,13,15) |
| InChIKey | MJIKEZHITOBJOU-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 104.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.24 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|