C14H18N4O — CID 77043825
3-(2-ethylimidazol-1-yl)-N'-hydroxy-2-phenylpropanimidamide (PubChem CID 77043825) has the molecular formula C14H18N4O and a molecular weight of 258.32 g/mol. Its IUPAC name is 3-(2-ethylimidazol-1-yl)-N'-hydroxy-2-phenylpropanimidamide.
| Compound Name | 3-(2-ethylimidazol-1-yl)-N'-hydroxy-2-phenylpropanimidamide |
|---|---|
| PubChem CID | 77043825 |
| Molecular Formula | C14H18N4O |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | 3-(2-ethylimidazol-1-yl)-N'-hydroxy-2-phenylpropanimidamide |
| SMILES | CCc1nccn1CC(C(N)=NO)c1ccccc1 |
| InChI | InChI=1S/C14H18N4O/c1-2-13-16-8-9-18(13)10-12(14(15)17-19)11-6-4-3-5-7-11/h3-9,12,19H,2,10H2,1H3,(H2,15,17) |
| InChIKey | SVFJCVNLKINVRY-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|