C15H22N2OS — CID 77044152
3-cyclohexylsulfanyl-N'-hydroxy-2-phenylpropanimidamide (PubChem CID 77044152) has the molecular formula C15H22N2OS and a molecular weight of 278.42 g/mol. Its IUPAC name is 3-cyclohexylsulfanyl-N'-hydroxy-2-phenylpropanimidamide.
| Compound Name | 3-cyclohexylsulfanyl-N'-hydroxy-2-phenylpropanimidamide |
|---|---|
| PubChem CID | 77044152 |
| Molecular Formula | C15H22N2OS |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | 3-cyclohexylsulfanyl-N'-hydroxy-2-phenylpropanimidamide |
| SMILES | NC(=NO)C(CSC1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C15H22N2OS/c16-15(17-18)14(12-7-3-1-4-8-12)11-19-13-9-5-2-6-10-13/h1,3-4,7-8,13-14,18H,2,5-6,9-11H2,(H2,16,17) |
| InChIKey | QUDTYVVJMMAVTD-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|