C12H14N4OS3 — CID 115383021
N'-hydroxy-3-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-2-phenylpropanimidamide (PubChem CID 115383021) has the molecular formula C12H14N4OS3 and a molecular weight of 326.47 g/mol. Its IUPAC name is N'-hydroxy-3-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-2-phenylpropanimidamide.
| Compound Name | N'-hydroxy-3-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-2-phenylpropanimidamide |
|---|---|
| PubChem CID | 115383021 |
| Molecular Formula | C12H14N4OS3 |
| Molecular Weight | 326.47 g/mol |
| Exact Mass | 326.03 |
| IUPAC Name | N'-hydroxy-3-[(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)sulfanyl]-2-phenylpropanimidamide |
| SMILES | CSc1nnc(SCC(/C(N)=N/O)c2ccccc2)s1 |
| InChI | InChI=1S/C12H14N4OS3/c1-18-11-14-15-12(20-11)19-7-9(10(13)16-17)8-5-3-2-4-6-8/h2-6,9,17H,7H2,1H3,(H2,13,16) |
| InChIKey | UPJUQOKRNRKLEX-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 84.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.47 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|