C22H31O7PS2 — CID 77050639
2-(2-diethoxyphosphoryloxyethyldisulfanyl)ethyl (2S)-2-(6-methoxynaphthalen-2-yl)propanoate (PubChem CID 77050639) has the molecular formula C22H31O7PS2 and a molecular weight of 502.59 g/mol. Its IUPAC name is 2-(2-diethoxyphosphoryloxyethyldisulfanyl)ethyl (2S)-2-(6-methoxynaphthalen-2-yl)propanoate.
| Compound Name | 2-(2-diethoxyphosphoryloxyethyldisulfanyl)ethyl (2S)-2-(6-methoxynaphthalen-2-yl)propanoate |
|---|---|
| PubChem CID | 77050639 |
| Molecular Formula | C22H31O7PS2 |
| Molecular Weight | 502.59 g/mol |
| Exact Mass | 502.12 |
| IUPAC Name | 2-(2-diethoxyphosphoryloxyethyldisulfanyl)ethyl (2S)-2-(6-methoxynaphthalen-2-yl)propanoate |
| SMILES | CCOP(=O)(OCC)OCCSSCCOC(=O)[C@@H](C)c1ccc2cc(OC)ccc2c1 |
| InChI | InChI=1S/C22H31O7PS2/c1-5-27-30(24,28-6-2)29-12-14-32-31-13-11-26-22(23)17(3)18-7-8-20-16-21(25-4)10-9-19(20)15-18/h7-10,15-17H,5-6,11-14H2,1-4H3/t17-/m0/s1 |
| InChIKey | QBDWHGHCJJSAKW-KRWDZBQOSA-N |
| XLogP | 6.07 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.59 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|