C21H35O6PS2 — CID 90341363
2-(2-diethoxyphosphoryloxyethyldisulfanyl)ethyl 2-[4-(2-methylpropyl)phenyl]propanoate (PubChem CID 90341363) has the molecular formula C21H35O6PS2 and a molecular weight of 478.61 g/mol. Its IUPAC name is 2-(2-diethoxyphosphoryloxyethyldisulfanyl)ethyl 2-[4-(2-methylpropyl)phenyl]propanoate.
| Compound Name | 2-(2-diethoxyphosphoryloxyethyldisulfanyl)ethyl 2-[4-(2-methylpropyl)phenyl]propanoate |
|---|---|
| PubChem CID | 90341363 |
| Molecular Formula | C21H35O6PS2 |
| Molecular Weight | 478.61 g/mol |
| Exact Mass | 478.16 |
| IUPAC Name | 2-(2-diethoxyphosphoryloxyethyldisulfanyl)ethyl 2-[4-(2-methylpropyl)phenyl]propanoate |
| SMILES | CCOP(=O)(OCC)OCCSSCCOC(=O)C(C)c1ccc(CC(C)C)cc1 |
| InChI | InChI=1S/C21H35O6PS2/c1-6-25-28(23,26-7-2)27-13-15-30-29-14-12-24-21(22)18(5)20-10-8-19(9-11-20)16-17(3)4/h8-11,17-18H,6-7,12-16H2,1-5H3 |
| InChIKey | BSPRXTVPTKVOMC-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.61 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|