C11H19N5OS — CID 77058053
2-[4-(4,5-dimethyl-1,3-thiazol-2-yl)piperazin-1-yl]-N'-hydroxyethanimidamide (PubChem CID 77058053) has the molecular formula C11H19N5OS and a molecular weight of 269.37 g/mol. Its IUPAC name is 2-[4-(4,5-dimethyl-1,3-thiazol-2-yl)piperazin-1-yl]-N'-hydroxyethanimidamide.
| Compound Name | 2-[4-(4,5-dimethyl-1,3-thiazol-2-yl)piperazin-1-yl]-N'-hydroxyethanimidamide |
|---|---|
| PubChem CID | 77058053 |
| Molecular Formula | C11H19N5OS |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | 2-[4-(4,5-dimethyl-1,3-thiazol-2-yl)piperazin-1-yl]-N'-hydroxyethanimidamide |
| SMILES | Cc1nc(N2CCN(CC(N)=NO)CC2)sc1C |
| InChI | InChI=1S/C11H19N5OS/c1-8-9(2)18-11(13-8)16-5-3-15(4-6-16)7-10(12)14-17/h17H,3-7H2,1-2H3,(H2,12,14) |
| InChIKey | GLDKONSUBNVOFY-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 77.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|