C7H15N5O2S — CID 77059910
[2-oxo-2-(propylcarbamoylamino)ethyl] N'-aminocarbamimidothioate (PubChem CID 77059910) has the molecular formula C7H15N5O2S and a molecular weight of 233.30 g/mol. Its IUPAC name is [2-oxo-2-(propylcarbamoylamino)ethyl] N'-aminocarbamimidothioate.
| Compound Name | [2-oxo-2-(propylcarbamoylamino)ethyl] N'-aminocarbamimidothioate |
|---|---|
| PubChem CID | 77059910 |
| Molecular Formula | C7H15N5O2S |
| Molecular Weight | 233.30 g/mol |
| Exact Mass | 233.09 |
| IUPAC Name | [2-oxo-2-(propylcarbamoylamino)ethyl] N'-aminocarbamimidothioate |
| SMILES | CCCNC(=O)NC(=O)CSC(N)=NN |
| InChI | InChI=1S/C7H15N5O2S/c1-2-3-10-7(14)11-5(13)4-15-6(8)12-9/h2-4,9H2,1H3,(H2,8,12)(H2,10,11,13,14) |
| InChIKey | XIANFNGLOAOHLM-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 122.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.30 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|