C9H10N6O2S — CID 77061104
[2-oxo-2-(3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)ethyl] N'-aminocarbamimidothioate (PubChem CID 77061104) has the molecular formula C9H10N6O2S and a molecular weight of 266.29 g/mol. Its IUPAC name is [2-oxo-2-(3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)ethyl] N'-aminocarbamimidothioate.
| Compound Name | [2-oxo-2-(3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)ethyl] N'-aminocarbamimidothioate |
|---|---|
| PubChem CID | 77061104 |
| Molecular Formula | C9H10N6O2S |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | [2-oxo-2-(3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)ethyl] N'-aminocarbamimidothioate |
| SMILES | NN=C(N)SCC(=O)n1nc2ccccn2c1=O |
| InChI | InChI=1S/C9H10N6O2S/c10-8(12-11)18-5-7(16)15-9(17)14-4-2-1-3-6(14)13-15/h1-4H,5,11H2,(H2,10,12) |
| InChIKey | BIJXRXZVWSOILQ-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|