C10H11N3O3S — CID 43502529
2-[2-(2-hydroxyethylsulfanyl)acetyl]-[1,2,4]triazolo[4,3-a]pyridin-3-one (PubChem CID 43502529) has the molecular formula C10H11N3O3S and a molecular weight of 253.28 g/mol. Its IUPAC name is 2-[2-(2-hydroxyethylsulfanyl)acetyl]-[1,2,4]triazolo[4,3-a]pyridin-3-one.
| Compound Name | 2-[2-(2-hydroxyethylsulfanyl)acetyl]-[1,2,4]triazolo[4,3-a]pyridin-3-one |
|---|---|
| PubChem CID | 43502529 |
| Molecular Formula | C10H11N3O3S |
| Molecular Weight | 253.28 g/mol |
| Exact Mass | 253.05 |
| IUPAC Name | 2-[2-(2-hydroxyethylsulfanyl)acetyl]-[1,2,4]triazolo[4,3-a]pyridin-3-one |
| SMILES | O=C(CSCCO)n1nc2ccccn2c1=O |
| InChI | InChI=1S/C10H11N3O3S/c14-5-6-17-7-9(15)13-10(16)12-4-2-1-3-8(12)11-13/h1-4,14H,5-7H2 |
| InChIKey | OHPMZLMPDFEUES-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 76.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.28 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|