C8H6N6O2 — CID 55138769
2-(2-azidoacetyl)-[1,2,4]triazolo[4,3-a]pyridin-3-one (PubChem CID 55138769) has the molecular formula C8H6N6O2 and a molecular weight of 218.18 g/mol. Its IUPAC name is 2-(2-azidoacetyl)-[1,2,4]triazolo[4,3-a]pyridin-3-one.
| Compound Name | 2-(2-azidoacetyl)-[1,2,4]triazolo[4,3-a]pyridin-3-one |
|---|---|
| PubChem CID | 55138769 |
| Molecular Formula | C8H6N6O2 |
| Molecular Weight | 218.18 g/mol |
| Exact Mass | 218.06 |
| IUPAC Name | 2-(2-azidoacetyl)-[1,2,4]triazolo[4,3-a]pyridin-3-one |
| SMILES | [N-]=[N+]=NCC(=O)n1nc2ccccn2c1=O |
| InChI | InChI=1S/C8H6N6O2/c9-12-10-5-7(15)14-8(16)13-4-2-1-3-6(13)11-14/h1-4H,5H2 |
| InChIKey | UEAOSPIQLAAQTF-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 105.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.18 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|