C11H21N5O2S — CID 77064340
N'-hydroxy-3-[2-methoxyethyl-(3-propyl-1,2,4-thiadiazol-5-yl)amino]propanimidamide (PubChem CID 77064340) has the molecular formula C11H21N5O2S and a molecular weight of 287.39 g/mol. Its IUPAC name is N'-hydroxy-3-[2-methoxyethyl-(3-propyl-1,2,4-thiadiazol-5-yl)amino]propanimidamide.
| Compound Name | N'-hydroxy-3-[2-methoxyethyl-(3-propyl-1,2,4-thiadiazol-5-yl)amino]propanimidamide |
|---|---|
| PubChem CID | 77064340 |
| Molecular Formula | C11H21N5O2S |
| Molecular Weight | 287.39 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | N'-hydroxy-3-[2-methoxyethyl-(3-propyl-1,2,4-thiadiazol-5-yl)amino]propanimidamide |
| SMILES | CCCc1nsc(N(CCOC)CCC(N)=NO)n1 |
| InChI | InChI=1S/C11H21N5O2S/c1-3-4-10-13-11(19-15-10)16(7-8-18-2)6-5-9(12)14-17/h17H,3-8H2,1-2H3,(H2,12,14) |
| InChIKey | MWAMBQBHKZTQRS-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.39 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|