C11H15Cl2N3O — CID 77065105
2-[(2,5-dichlorophenyl)methyl-methylamino]-N'-hydroxypropanimidamide (PubChem CID 77065105) has the molecular formula C11H15Cl2N3O and a molecular weight of 276.17 g/mol. Its IUPAC name is 2-[(2,5-dichlorophenyl)methyl-methylamino]-N'-hydroxypropanimidamide.
| Compound Name | 2-[(2,5-dichlorophenyl)methyl-methylamino]-N'-hydroxypropanimidamide |
|---|---|
| PubChem CID | 77065105 |
| Molecular Formula | C11H15Cl2N3O |
| Molecular Weight | 276.17 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | 2-[(2,5-dichlorophenyl)methyl-methylamino]-N'-hydroxypropanimidamide |
| SMILES | CC(C(N)=NO)N(C)Cc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C11H15Cl2N3O/c1-7(11(14)15-17)16(2)6-8-5-9(12)3-4-10(8)13/h3-5,7,17H,6H2,1-2H3,(H2,14,15) |
| InChIKey | YNQYHMMEALPKRV-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.17 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|