C21H21NO4S — CID 7707010
(2Z)-3-[2-(4-methoxyphenoxy)ethyl]-2-[2-(2-methylphenyl)-2-oxoethylidene]-1,3-thiazolidin-4-one (PubChem CID 7707010) has the molecular formula C21H21NO4S and a molecular weight of 383.47 g/mol. Its IUPAC name is (2Z)-3-[2-(4-methoxyphenoxy)ethyl]-2-[2-(2-methylphenyl)-2-oxoethylidene]-1,3-thiazolidin-4-one.
| Compound Name | (2Z)-3-[2-(4-methoxyphenoxy)ethyl]-2-[2-(2-methylphenyl)-2-oxoethylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 7707010 |
| Molecular Formula | C21H21NO4S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | (2Z)-3-[2-(4-methoxyphenoxy)ethyl]-2-[2-(2-methylphenyl)-2-oxoethylidene]-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(OCCN2C(=O)CS/C2=C\C(=O)c2ccccc2C)cc1 |
| InChI | InChI=1S/C21H21NO4S/c1-15-5-3-4-6-18(15)19(23)13-21-22(20(24)14-27-21)11-12-26-17-9-7-16(25-2)8-10-17/h3-10,13H,11-12,14H2,1-2H3/b21-13- |
| InChIKey | PLZBBASNQYQYOQ-BKUYFWCQSA-N |
| XLogP | 3.68 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|