C20H19NO2S — CID 7707024
(2Z)-3-[(2-methylphenyl)methyl]-2-[2-(2-methylphenyl)-2-oxoethylidene]-1,3-thiazolidin-4-one (PubChem CID 7707024) has the molecular formula C20H19NO2S and a molecular weight of 337.44 g/mol. Its IUPAC name is (2Z)-3-[(2-methylphenyl)methyl]-2-[2-(2-methylphenyl)-2-oxoethylidene]-1,3-thiazolidin-4-one.
| Compound Name | (2Z)-3-[(2-methylphenyl)methyl]-2-[2-(2-methylphenyl)-2-oxoethylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 7707024 |
| Molecular Formula | C20H19NO2S |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | (2Z)-3-[(2-methylphenyl)methyl]-2-[2-(2-methylphenyl)-2-oxoethylidene]-1,3-thiazolidin-4-one |
| SMILES | Cc1ccccc1CN1C(=O)CS/C1=C\C(=O)c1ccccc1C |
| InChI | InChI=1S/C20H19NO2S/c1-14-7-3-5-9-16(14)12-21-19(23)13-24-20(21)11-18(22)17-10-6-4-8-15(17)2/h3-11H,12-13H2,1-2H3/b20-11- |
| InChIKey | CNISRUISWLUUHU-JAIQZWGSSA-N |
| XLogP | 4.10 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|