C14H20N2OS — CID 77070997
2-[1-[(2,4-dimethylphenyl)sulfanylmethyl]cyclopropyl]-N'-hydroxyethanimidamide (PubChem CID 77070997) has the molecular formula C14H20N2OS and a molecular weight of 264.39 g/mol. Its IUPAC name is 2-[1-[(2,4-dimethylphenyl)sulfanylmethyl]cyclopropyl]-N'-hydroxyethanimidamide.
| Compound Name | 2-[1-[(2,4-dimethylphenyl)sulfanylmethyl]cyclopropyl]-N'-hydroxyethanimidamide |
|---|---|
| PubChem CID | 77070997 |
| Molecular Formula | C14H20N2OS |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | 2-[1-[(2,4-dimethylphenyl)sulfanylmethyl]cyclopropyl]-N'-hydroxyethanimidamide |
| SMILES | Cc1ccc(SCC2(CC(N)=NO)CC2)c(C)c1 |
| InChI | InChI=1S/C14H20N2OS/c1-10-3-4-12(11(2)7-10)18-9-14(5-6-14)8-13(15)16-17/h3-4,7,17H,5-6,8-9H2,1-2H3,(H2,15,16) |
| InChIKey | HYBGEHFTISZGSZ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|