C8H8BrF2N3O — CID 77071872
2-(4-bromo-2,6-difluoroanilino)-N'-hydroxyethanimidamide (PubChem CID 77071872) has the molecular formula C8H8BrF2N3O and a molecular weight of 280.07 g/mol. Its IUPAC name is 2-(4-bromo-2,6-difluoroanilino)-N'-hydroxyethanimidamide.
| Compound Name | 2-(4-bromo-2,6-difluoroanilino)-N'-hydroxyethanimidamide |
|---|---|
| PubChem CID | 77071872 |
| Molecular Formula | C8H8BrF2N3O |
| Molecular Weight | 280.07 g/mol |
| Exact Mass | 278.98 |
| IUPAC Name | 2-(4-bromo-2,6-difluoroanilino)-N'-hydroxyethanimidamide |
| SMILES | NC(CNc1c(F)cc(Br)cc1F)=NO |
| InChI | InChI=1S/C8H8BrF2N3O/c9-4-1-5(10)8(6(11)2-4)13-3-7(12)14-15/h1-2,13,15H,3H2,(H2,12,14) |
| InChIKey | ARZNGRMWEDNICT-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.07 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|