C13H15N5O — CID 77082727
1H-pyrazol-4-yl-(4-pyridin-3-ylpiperazin-1-yl)methanone (PubChem CID 77082727) has the molecular formula C13H15N5O and a molecular weight of 257.30 g/mol. Its IUPAC name is 1H-pyrazol-4-yl-(4-pyridin-3-ylpiperazin-1-yl)methanone.
| Compound Name | 1H-pyrazol-4-yl-(4-pyridin-3-ylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 77082727 |
| Molecular Formula | C13H15N5O |
| Molecular Weight | 257.30 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | 1H-pyrazol-4-yl-(4-pyridin-3-ylpiperazin-1-yl)methanone |
| SMILES | O=C(c1cn[nH]c1)N1CCN(c2cccnc2)CC1 |
| InChI | InChI=1S/C13H15N5O/c19-13(11-8-15-16-9-11)18-6-4-17(5-7-18)12-2-1-3-14-10-12/h1-3,8-10H,4-7H2,(H,15,16) |
| InChIKey | PEBQMPFXQJPAQL-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.30 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |