C14H21N3O4S — CID 77085377
1-ethyl-4-(4-methylsulfonyl-1,4-diazepane-1-carbonyl)pyridin-2-one (PubChem CID 77085377) has the molecular formula C14H21N3O4S and a molecular weight of 327.41 g/mol. Its IUPAC name is 1-ethyl-4-(4-methylsulfonyl-1,4-diazepane-1-carbonyl)pyridin-2-one.
| Compound Name | 1-ethyl-4-(4-methylsulfonyl-1,4-diazepane-1-carbonyl)pyridin-2-one |
|---|---|
| PubChem CID | 77085377 |
| Molecular Formula | C14H21N3O4S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 1-ethyl-4-(4-methylsulfonyl-1,4-diazepane-1-carbonyl)pyridin-2-one |
| SMILES | CCn1ccc(C(=O)N2CCCN(S(C)(=O)=O)CC2)cc1=O |
| InChI | InChI=1S/C14H21N3O4S/c1-3-15-8-5-12(11-13(15)18)14(19)16-6-4-7-17(10-9-16)22(2,20)21/h5,8,11H,3-4,6-7,9-10H2,1-2H3 |
| InChIKey | WIEHMIFMJIAXRH-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 79.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |