C15H16N2O3S — CID 77085920
N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-1-ethylindole-5-carboxamide (PubChem CID 77085920) has the molecular formula C15H16N2O3S and a molecular weight of 304.37 g/mol. Its IUPAC name is N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-1-ethylindole-5-carboxamide.
| Compound Name | N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-1-ethylindole-5-carboxamide |
|---|---|
| PubChem CID | 77085920 |
| Molecular Formula | C15H16N2O3S |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | N-(1,1-dioxo-2,3-dihydrothiophen-3-yl)-1-ethylindole-5-carboxamide |
| SMILES | CCn1ccc2cc(C(=O)NC3C=CS(=O)(=O)C3)ccc21 |
| InChI | InChI=1S/C15H16N2O3S/c1-2-17-7-5-11-9-12(3-4-14(11)17)15(18)16-13-6-8-21(19,20)10-13/h3-9,13H,2,10H2,1H3,(H,16,18) |
| InChIKey | AGNNZGMFYAXPMO-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |