C18H23NO3 — CID 77092593
3-(3-methoxyphenoxy)-1-[(5-propylfuran-2-yl)methyl]azetidine (PubChem CID 77092593) has the molecular formula C18H23NO3 and a molecular weight of 301.39 g/mol. Its IUPAC name is 3-(3-methoxyphenoxy)-1-[(5-propylfuran-2-yl)methyl]azetidine.
| Compound Name | 3-(3-methoxyphenoxy)-1-[(5-propylfuran-2-yl)methyl]azetidine |
|---|---|
| PubChem CID | 77092593 |
| Molecular Formula | C18H23NO3 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | 3-(3-methoxyphenoxy)-1-[(5-propylfuran-2-yl)methyl]azetidine |
| SMILES | CCCc1ccc(CN2CC(Oc3cccc(OC)c3)C2)o1 |
| InChI | InChI=1S/C18H23NO3/c1-3-5-14-8-9-17(21-14)11-19-12-18(13-19)22-16-7-4-6-15(10-16)20-2/h4,6-10,18H,3,5,11-13H2,1-2H3 |
| InChIKey | VAFIHPUWJDVYMT-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 34.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |