About 3-[4-(3-chloro-4-fluorophenyl)piperazine-1-carbonyl]-1,4,6-trimethylpyridin-2-one
3-[4-(3-chloro-4-fluorophenyl)piperazine-1-carbonyl]-1,4,6-trimethylpyridin-2-one (PubChem CID 77092812) has the molecular formula C19H21ClFN3O2
and a molecular weight of 377.85 g/mol. Its IUPAC name is 3-[4-(3-chloro-4-fluorophenyl)piperazine-1-carbonyl]-1,4,6-trimethylpyridin-2-one.
Molecular Properties
| Compound Name | 3-[4-(3-chloro-4-fluorophenyl)piperazine-1-carbonyl]-1,4,6-trimethylpyridin-2-one |
| PubChem CID | 77092812 |
| Molecular Formula | C19H21ClFN3O2 |
| Molecular Weight | 377.85 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | 3-[4-(3-chloro-4-fluorophenyl)piperazine-1-carbonyl]-1,4,6-trimethylpyridin-2-one |
| SMILES | Cc1cc(C)n(C)c(=O)c1C(=O)N1CCN(c2ccc(F)c(Cl)c2)CC1 |
| InChI | InChI=1S/C19H21ClFN3O2/c1-12-10-13(2)22(3)18(25)17(12)19(26)24-8-6-23(7-9-24)14-4-5-16(21)15(20)11-14/h4-5,10-11H,6-9H2,1-3H3 |
| InChIKey | FYQAKCUDPPADIB-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.85 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[4-(3-chloro-4-fluorophenyl)piperazine-1-carbonyl]-1,4,6-trimethylpyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(3-chloro-4-fluorophenyl)piperazine-1-carbonyl]-1,4,6-trimethylpyridin-2-one?
The IUPAC name of 3-[4-(3-chloro-4-fluorophenyl)piperazine-1-carbonyl]-1,4,6-trimethylpyridin-2-one (CID 77092812) is 3-[4-(3-chloro-4-fluorophenyl)piperazine-1-carbonyl]-1,4,6-trimethylpyridin-2-one.
What is the SMILES notation for 3-[4-(3-chloro-4-fluorophenyl)piperazine-1-carbonyl]-1,4,6-trimethylpyridin-2-one?
The canonical SMILES for 3-[4-(3-chloro-4-fluorophenyl)piperazine-1-carbonyl]-1,4,6-trimethylpyridin-2-one is Cc1cc(C)n(C)c(=O)c1C(=O)N1CCN(c2ccc(F)c(Cl)c2)CC1.
What is the InChIKey of 3-[4-(3-chloro-4-fluorophenyl)piperazine-1-carbonyl]-1,4,6-trimethylpyridin-2-one?
The InChIKey is FYQAKCUDPPADIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21ClFN3O2/c1-12-10-13(2)22(3)18(25)17(12)19(26)24-8-6-23(7-9-24)14-4-5-16(21)15(20)11-14/h4-5,10-11H,6-9H2,1-3H3.
What are the key properties of 3-[4-(3-chloro-4-fluorophenyl)piperazine-1-carbonyl]-1,4,6-trimethylpyridin-2-one?
3-[4-(3-chloro-4-fluorophenyl)piperazine-1-carbonyl]-1,4,6-trimethylpyridin-2-one has a molecular weight of 377.85 g/mol, XLogP of 2.76, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(3-chloro-4-fluorophenyl)piperazine-1-carbonyl]-1,4,6-trimethylpyridin-2-one is sourced from PubChem (CID 77092812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).