C17H21ClFN3 — CID 77097645
N-[(2-chloro-6-fluorophenyl)methyl]-N-[(2-propan-2-ylpyrimidin-4-yl)methyl]ethanamine (PubChem CID 77097645) has the molecular formula C17H21ClFN3 and a molecular weight of 321.83 g/mol. Its IUPAC name is N-[(2-chloro-6-fluorophenyl)methyl]-N-[(2-propan-2-ylpyrimidin-4-yl)methyl]ethanamine.
| Compound Name | N-[(2-chloro-6-fluorophenyl)methyl]-N-[(2-propan-2-ylpyrimidin-4-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 77097645 |
| Molecular Formula | C17H21ClFN3 |
| Molecular Weight | 321.83 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | N-[(2-chloro-6-fluorophenyl)methyl]-N-[(2-propan-2-ylpyrimidin-4-yl)methyl]ethanamine |
| SMILES | CCN(Cc1ccnc(C(C)C)n1)Cc1c(F)cccc1Cl |
| InChI | InChI=1S/C17H21ClFN3/c1-4-22(11-14-15(18)6-5-7-16(14)19)10-13-8-9-20-17(21-13)12(2)3/h5-9,12H,4,10-11H2,1-3H3 |
| InChIKey | LFYHRNNERSFDQY-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.83 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |