C13H22N4O2S — CID 77098104
(2S)-2-acetamido-N-[(1-ethylpyrazol-4-yl)methyl]-4-methylsulfanylbutanamide (PubChem CID 77098104) has the molecular formula C13H22N4O2S and a molecular weight of 298.41 g/mol. Its IUPAC name is (2S)-2-acetamido-N-[(1-ethylpyrazol-4-yl)methyl]-4-methylsulfanylbutanamide.
| Compound Name | (2S)-2-acetamido-N-[(1-ethylpyrazol-4-yl)methyl]-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 77098104 |
| Molecular Formula | C13H22N4O2S |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | (2S)-2-acetamido-N-[(1-ethylpyrazol-4-yl)methyl]-4-methylsulfanylbutanamide |
| SMILES | CCn1cc(CNC(=O)[C@H](CCSC)NC(C)=O)cn1 |
| InChI | InChI=1S/C13H22N4O2S/c1-4-17-9-11(8-15-17)7-14-13(19)12(5-6-20-3)16-10(2)18/h8-9,12H,4-7H2,1-3H3,(H,14,19)(H,16,18)/t12-/m0/s1 |
| InChIKey | SMHDWBYTWCXRLJ-LBPRGKRZSA-N |
| XLogP | 0.78 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |