C12H14FN3O3S — CID 77099054
2-[[(1,1-dioxo-2,3-dihydrothiophen-3-yl)amino]methyl]-5-fluoro-N'-hydroxybenzenecarboximidamide (PubChem CID 77099054) has the molecular formula C12H14FN3O3S and a molecular weight of 299.33 g/mol. Its IUPAC name is 2-[[(1,1-dioxo-2,3-dihydrothiophen-3-yl)amino]methyl]-5-fluoro-N'-hydroxybenzenecarboximidamide.
| Compound Name | 2-[[(1,1-dioxo-2,3-dihydrothiophen-3-yl)amino]methyl]-5-fluoro-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 77099054 |
| Molecular Formula | C12H14FN3O3S |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | 2-[[(1,1-dioxo-2,3-dihydrothiophen-3-yl)amino]methyl]-5-fluoro-N'-hydroxybenzenecarboximidamide |
| SMILES | NC(=NO)c1cc(F)ccc1CNC1C=CS(=O)(=O)C1 |
| InChI | InChI=1S/C12H14FN3O3S/c13-9-2-1-8(11(5-9)12(14)16-17)6-15-10-3-4-20(18,19)7-10/h1-5,10,15,17H,6-7H2,(H2,14,16) |
| InChIKey | DZXYUHVFDNLYJP-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 104.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|