C11H21N3O — CID 77100640
1-but-2-enyl-N,N-dimethylpiperazine-2-carboxamide (PubChem CID 77100640) has the molecular formula C11H21N3O and a molecular weight of 211.31 g/mol. Its IUPAC name is 1-but-2-enyl-N,N-dimethylpiperazine-2-carboxamide.
| Compound Name | 1-but-2-enyl-N,N-dimethylpiperazine-2-carboxamide |
|---|---|
| PubChem CID | 77100640 |
| Molecular Formula | C11H21N3O |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.17 |
| IUPAC Name | 1-but-2-enyl-N,N-dimethylpiperazine-2-carboxamide |
| SMILES | CC=CCN1CCNCC1C(=O)N(C)C |
| InChI | InChI=1S/C11H21N3O/c1-4-5-7-14-8-6-12-9-10(14)11(15)13(2)3/h4-5,10,12H,6-9H2,1-3H3 |
| InChIKey | DGKHAZPUUBDKTN-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|