C11H13F3N2O2 — CID 77101183
methyl 2-ethyl-4-[4-(trifluoromethyl)pyrazol-1-yl]but-2-enoate (PubChem CID 77101183) has the molecular formula C11H13F3N2O2 and a molecular weight of 262.23 g/mol. Its IUPAC name is methyl 2-ethyl-4-[4-(trifluoromethyl)pyrazol-1-yl]but-2-enoate.
| Compound Name | methyl 2-ethyl-4-[4-(trifluoromethyl)pyrazol-1-yl]but-2-enoate |
|---|---|
| PubChem CID | 77101183 |
| Molecular Formula | C11H13F3N2O2 |
| Molecular Weight | 262.23 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | methyl 2-ethyl-4-[4-(trifluoromethyl)pyrazol-1-yl]but-2-enoate |
| SMILES | CCC(=CCn1cc(C(F)(F)F)cn1)C(=O)OC |
| InChI | InChI=1S/C11H13F3N2O2/c1-3-8(10(17)18-2)4-5-16-7-9(6-15-16)11(12,13)14/h4,6-7H,3,5H2,1-2H3 |
| InChIKey | PHTLBPKINZTXJI-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.23 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|