C17H21NO3 — CID 77104225
1-(3-cyclopropyl-3-hydroxyazetidin-1-yl)-3-(4-ethoxyphenyl)prop-2-en-1-one (PubChem CID 77104225) has the molecular formula C17H21NO3 and a molecular weight of 287.36 g/mol. Its IUPAC name is 1-(3-cyclopropyl-3-hydroxyazetidin-1-yl)-3-(4-ethoxyphenyl)prop-2-en-1-one.
| Compound Name | 1-(3-cyclopropyl-3-hydroxyazetidin-1-yl)-3-(4-ethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 77104225 |
| Molecular Formula | C17H21NO3 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | 1-(3-cyclopropyl-3-hydroxyazetidin-1-yl)-3-(4-ethoxyphenyl)prop-2-en-1-one |
| SMILES | CCOc1ccc(C=CC(=O)N2CC(O)(C3CC3)C2)cc1 |
| InChI | InChI=1S/C17H21NO3/c1-2-21-15-8-3-13(4-9-15)5-10-16(19)18-11-17(20,12-18)14-6-7-14/h3-5,8-10,14,20H,2,6-7,11-12H2,1H3 |
| InChIKey | JUPUUDSQUHMDSV-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|