C36H46N4O2S+2 — CID 77105694
3-[butyl-[7-methoxy-4-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)methyl]-1-phenylquinolin-1-ium-2-yl]amino]propyl-(2-hydroxyethyl)-dimethylazanium (PubChem CID 77105694) has the molecular formula C36H46N4O2S+2 and a molecular weight of 598.86 g/mol. Its IUPAC name is 3-[butyl-[7-methoxy-4-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)methyl]-1-phenylquinolin-1-ium-2-yl]amino]propyl-(2-hydroxyethyl)-dimethylazanium.
| Compound Name | 3-[butyl-[7-methoxy-4-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)methyl]-1-phenylquinolin-1-ium-2-yl]amino]propyl-(2-hydroxyethyl)-dimethylazanium |
|---|---|
| PubChem CID | 77105694 |
| Molecular Formula | C36H46N4O2S+2 |
| Molecular Weight | 598.86 g/mol |
| Exact Mass | 598.33 |
| IUPAC Name | 3-[butyl-[7-methoxy-4-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)methyl]-1-phenylquinolin-1-ium-2-yl]amino]propyl-(2-hydroxyethyl)-dimethylazanium |
| SMILES | CCCCN(CCC[N+](C)(C)CCO)c1cc(/C=C2\Sc3ccccc3N2C)c2ccc(OC)cc2[n+]1-c1ccccc1 |
| InChI | InChI=1S/C36H46N4O2S/c1-6-7-20-38(21-13-22-40(3,4)23-24-41)35-25-28(26-36-37(2)32-16-11-12-17-34(32)43-36)31-19-18-30(42-5)27-33(31)39(35)29-14-9-8-10-15-29/h8-12,14-19,25-27,41H,6-7,13,20-24H2,1-5H3/q+2 |
| InChIKey | GVRAVSMSYOAYRH-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 39.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.86 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|