C23H35NO5 — CID 77105809
2-[[2-[[(3S)-17-hydroxy-10,13-dimethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]acetyl]amino]acetic acid (PubChem CID 77105809) has the molecular formula C23H35NO5 and a molecular weight of 405.54 g/mol. Its IUPAC name is 2-[[2-[[(3S)-17-hydroxy-10,13-dimethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]acetyl]amino]acetic acid.
| Compound Name | 2-[[2-[[(3S)-17-hydroxy-10,13-dimethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]acetyl]amino]acetic acid |
|---|---|
| PubChem CID | 77105809 |
| Molecular Formula | C23H35NO5 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.25 |
| IUPAC Name | 2-[[2-[[(3S)-17-hydroxy-10,13-dimethyl-2,3,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]acetyl]amino]acetic acid |
| SMILES | CC12CC[C@H](OCC(=O)NCC(=O)O)C=C1CCC1C2CCC2(C)C(O)CCC12 |
| InChI | InChI=1S/C23H35NO5/c1-22-9-7-15(29-13-20(26)24-12-21(27)28)11-14(22)3-4-16-17-5-6-19(25)23(17,2)10-8-18(16)22/h11,15-19,25H,3-10,12-13H2,1-2H3,(H,24,26)(H,27,28)/t15-,16?,17?,18?,19?,22?,23?/m0/s1 |
| InChIKey | QJGAOWVLCNVGMA-SIHWAMPKSA-N |
| XLogP | 2.90 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|