C20H16N2O7 — CID 77106570
(E)-but-2-enedioic acid;3,4-dimethoxy-1,6-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-3,5(16),6,8,10,12,14-heptaen-2-one (PubChem CID 77106570) has the molecular formula C20H16N2O7 and a molecular weight of 396.36 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;3,4-dimethoxy-1,6-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-3,5(16),6,8,10,12,14-heptaen-2-one.
| Compound Name | (E)-but-2-enedioic acid;3,4-dimethoxy-1,6-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-3,5(16),6,8,10,12,14-heptaen-2-one |
|---|---|
| PubChem CID | 77106570 |
| Molecular Formula | C20H16N2O7 |
| Molecular Weight | 396.36 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | (E)-but-2-enedioic acid;3,4-dimethoxy-1,6-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-3,5(16),6,8,10,12,14-heptaen-2-one |
| SMILES | COc1c(OC)c2nccc3c4ccccc4n(c1=O)c23.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C16H12N2O3.C4H4O4/c1-20-14-12-13-10(7-8-17-12)9-5-3-4-6-11(9)18(13)16(19)15(14)21-2;5-3(6)1-2-4(7)8/h3-8H,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | IPOONZMAHMXNKE-WLHGVMLRSA-N |
| XLogP | 2.17 |
| TPSA | 127.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.36 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|