C16H8N4O — CID 11492776
1,11,14,17-tetrazapentacyclo[10.7.1.02,7.08,20.013,18]icosa-2,4,6,8(20),9,11,13,15,17-nonaen-19-one (PubChem CID 11492776) has the molecular formula C16H8N4O and a molecular weight of 272.27 g/mol. Its IUPAC name is 1,11,14,17-tetrazapentacyclo[10.7.1.02,7.08,20.013,18]icosa-2,4,6,8(20),9,11,13,15,17-nonaen-19-one.
| Compound Name | 1,11,14,17-tetrazapentacyclo[10.7.1.02,7.08,20.013,18]icosa-2,4,6,8(20),9,11,13,15,17-nonaen-19-one |
|---|---|
| PubChem CID | 11492776 |
| Molecular Formula | C16H8N4O |
| Molecular Weight | 272.27 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | 1,11,14,17-tetrazapentacyclo[10.7.1.02,7.08,20.013,18]icosa-2,4,6,8(20),9,11,13,15,17-nonaen-19-one |
| SMILES | O=c1c2nccnc2c2nccc3c4ccccc4n1c32 |
| InChI | InChI=1S/C16H8N4O/c21-16-14-12(18-7-8-19-14)13-15-10(5-6-17-13)9-3-1-2-4-11(9)20(15)16/h1-8H |
| InChIKey | IBQHMWYATBDGQZ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 60.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.27 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|