C33H40N4O2S+2 — CID 77106923
2-[ethyl-[7-methoxy-4-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)methyl]-1-phenylquinolin-1-ium-2-yl]amino]ethyl-(2-hydroxyethyl)-dimethylazanium (PubChem CID 77106923) has the molecular formula C33H40N4O2S+2 and a molecular weight of 556.78 g/mol. Its IUPAC name is 2-[ethyl-[7-methoxy-4-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)methyl]-1-phenylquinolin-1-ium-2-yl]amino]ethyl-(2-hydroxyethyl)-dimethylazanium.
| Compound Name | 2-[ethyl-[7-methoxy-4-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)methyl]-1-phenylquinolin-1-ium-2-yl]amino]ethyl-(2-hydroxyethyl)-dimethylazanium |
|---|---|
| PubChem CID | 77106923 |
| Molecular Formula | C33H40N4O2S+2 |
| Molecular Weight | 556.78 g/mol |
| Exact Mass | 556.29 |
| IUPAC Name | 2-[ethyl-[7-methoxy-4-[(Z)-(3-methyl-1,3-benzothiazol-2-ylidene)methyl]-1-phenylquinolin-1-ium-2-yl]amino]ethyl-(2-hydroxyethyl)-dimethylazanium |
| SMILES | CCN(CC[N+](C)(C)CCO)c1cc(/C=C2\Sc3ccccc3N2C)c2ccc(OC)cc2[n+]1-c1ccccc1 |
| InChI | InChI=1S/C33H40N4O2S/c1-6-35(18-19-37(3,4)20-21-38)32-22-25(23-33-34(2)29-14-10-11-15-31(29)40-33)28-17-16-27(39-5)24-30(28)36(32)26-12-8-7-9-13-26/h7-17,22-24,38H,6,18-21H2,1-5H3/q+2 |
| InChIKey | BEOBFNJCODCENT-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 39.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.78 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|