C14H19F2N3OS — CID 77108688
1-[(2,4-difluorophenyl)methyl]-N'-hydroxy-4-methylsulfanylpiperidine-4-carboximidamide (PubChem CID 77108688) has the molecular formula C14H19F2N3OS and a molecular weight of 315.39 g/mol. Its IUPAC name is 1-[(2,4-difluorophenyl)methyl]-N'-hydroxy-4-methylsulfanylpiperidine-4-carboximidamide.
| Compound Name | 1-[(2,4-difluorophenyl)methyl]-N'-hydroxy-4-methylsulfanylpiperidine-4-carboximidamide |
|---|---|
| PubChem CID | 77108688 |
| Molecular Formula | C14H19F2N3OS |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | 1-[(2,4-difluorophenyl)methyl]-N'-hydroxy-4-methylsulfanylpiperidine-4-carboximidamide |
| SMILES | CSC1(C(N)=NO)CCN(Cc2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C14H19F2N3OS/c1-21-14(13(17)18-20)4-6-19(7-5-14)9-10-2-3-11(15)8-12(10)16/h2-3,8,20H,4-7,9H2,1H3,(H2,17,18) |
| InChIKey | LWYFFPULHSCXEE-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|