C15H23N3OS — CID 77108640
N'-hydroxy-1-[(2-methylphenyl)methyl]-4-methylsulfanylpiperidine-4-carboximidamide (PubChem CID 77108640) has the molecular formula C15H23N3OS and a molecular weight of 293.44 g/mol. Its IUPAC name is N'-hydroxy-1-[(2-methylphenyl)methyl]-4-methylsulfanylpiperidine-4-carboximidamide.
| Compound Name | N'-hydroxy-1-[(2-methylphenyl)methyl]-4-methylsulfanylpiperidine-4-carboximidamide |
|---|---|
| PubChem CID | 77108640 |
| Molecular Formula | C15H23N3OS |
| Molecular Weight | 293.44 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | N'-hydroxy-1-[(2-methylphenyl)methyl]-4-methylsulfanylpiperidine-4-carboximidamide |
| SMILES | CSC1(C(N)=NO)CCN(Cc2ccccc2C)CC1 |
| InChI | InChI=1S/C15H23N3OS/c1-12-5-3-4-6-13(12)11-18-9-7-15(20-2,8-10-18)14(16)17-19/h3-6,19H,7-11H2,1-2H3,(H2,16,17) |
| InChIKey | GYDUMKLQYZEMLM-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.44 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|