C11H23N3OS2 — CID 104863540
1-(2-ethylsulfanylethyl)-N'-hydroxy-4-methylsulfanylpiperidine-4-carboximidamide (PubChem CID 104863540) has the molecular formula C11H23N3OS2 and a molecular weight of 277.46 g/mol. Its IUPAC name is 1-(2-ethylsulfanylethyl)-N'-hydroxy-4-methylsulfanylpiperidine-4-carboximidamide.
| Compound Name | 1-(2-ethylsulfanylethyl)-N'-hydroxy-4-methylsulfanylpiperidine-4-carboximidamide |
|---|---|
| PubChem CID | 104863540 |
| Molecular Formula | C11H23N3OS2 |
| Molecular Weight | 277.46 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | 1-(2-ethylsulfanylethyl)-N'-hydroxy-4-methylsulfanylpiperidine-4-carboximidamide |
| SMILES | CCSCCN1CCC(SC)(C(N)=NO)CC1 |
| InChI | InChI=1S/C11H23N3OS2/c1-3-17-9-8-14-6-4-11(16-2,5-7-14)10(12)13-15/h15H,3-9H2,1-2H3,(H2,12,13) |
| InChIKey | ZGQNBXPOVIBNCM-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.46 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|