C12H22F3N3O2S — CID 77108666
N'-hydroxy-4-methylsulfanyl-1-[3-(2,2,2-trifluoroethoxy)propyl]piperidine-4-carboximidamide (PubChem CID 77108666) has the molecular formula C12H22F3N3O2S and a molecular weight of 329.39 g/mol. Its IUPAC name is N'-hydroxy-4-methylsulfanyl-1-[3-(2,2,2-trifluoroethoxy)propyl]piperidine-4-carboximidamide.
| Compound Name | N'-hydroxy-4-methylsulfanyl-1-[3-(2,2,2-trifluoroethoxy)propyl]piperidine-4-carboximidamide |
|---|---|
| PubChem CID | 77108666 |
| Molecular Formula | C12H22F3N3O2S |
| Molecular Weight | 329.39 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | N'-hydroxy-4-methylsulfanyl-1-[3-(2,2,2-trifluoroethoxy)propyl]piperidine-4-carboximidamide |
| SMILES | CSC1(C(N)=NO)CCN(CCCOCC(F)(F)F)CC1 |
| InChI | InChI=1S/C12H22F3N3O2S/c1-21-11(10(16)17-19)3-6-18(7-4-11)5-2-8-20-9-12(13,14)15/h19H,2-9H2,1H3,(H2,16,17) |
| InChIKey | VYUMQXPBNSZJQH-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 71.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.39 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|