C14H19N3O3S — CID 77108996
phenyl 4-(N'-hydroxycarbamimidoyl)-4-methylsulfanylpiperidine-1-carboxylate (PubChem CID 77108996) has the molecular formula C14H19N3O3S and a molecular weight of 309.39 g/mol. Its IUPAC name is phenyl 4-(N'-hydroxycarbamimidoyl)-4-methylsulfanylpiperidine-1-carboxylate.
| Compound Name | phenyl 4-(N'-hydroxycarbamimidoyl)-4-methylsulfanylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 77108996 |
| Molecular Formula | C14H19N3O3S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | phenyl 4-(N'-hydroxycarbamimidoyl)-4-methylsulfanylpiperidine-1-carboxylate |
| SMILES | CSC1(C(N)=NO)CCN(C(=O)Oc2ccccc2)CC1 |
| InChI | InChI=1S/C14H19N3O3S/c1-21-14(12(15)16-19)7-9-17(10-8-14)13(18)20-11-5-3-2-4-6-11/h2-6,19H,7-10H2,1H3,(H2,15,16) |
| InChIKey | ADEBAYPCMXLJFK-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 88.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|