C13H20N2O3S — CID 77112421
N'-hydroxy-4-[2-(4-hydroxybutan-2-ylsulfanyl)ethoxy]benzenecarboximidamide (PubChem CID 77112421) has the molecular formula C13H20N2O3S and a molecular weight of 284.38 g/mol. Its IUPAC name is N'-hydroxy-4-[2-(4-hydroxybutan-2-ylsulfanyl)ethoxy]benzenecarboximidamide.
| Compound Name | N'-hydroxy-4-[2-(4-hydroxybutan-2-ylsulfanyl)ethoxy]benzenecarboximidamide |
|---|---|
| PubChem CID | 77112421 |
| Molecular Formula | C13H20N2O3S |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | N'-hydroxy-4-[2-(4-hydroxybutan-2-ylsulfanyl)ethoxy]benzenecarboximidamide |
| SMILES | CC(CCO)SCCOc1ccc(C(N)=NO)cc1 |
| InChI | InChI=1S/C13H20N2O3S/c1-10(6-7-16)19-9-8-18-12-4-2-11(3-5-12)13(14)15-17/h2-5,10,16-17H,6-9H2,1H3,(H2,14,15) |
| InChIKey | RHBYTTCIUGIEKZ-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 88.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|