C11H12N4O3 — CID 77120127
methyl 2-methyl-4-(3-oxo-[1,2,4]triazolo[4,3-a]pyrazin-2-yl)but-2-enoate (PubChem CID 77120127) has the molecular formula C11H12N4O3 and a molecular weight of 248.24 g/mol. Its IUPAC name is methyl 2-methyl-4-(3-oxo-[1,2,4]triazolo[4,3-a]pyrazin-2-yl)but-2-enoate.
| Compound Name | methyl 2-methyl-4-(3-oxo-[1,2,4]triazolo[4,3-a]pyrazin-2-yl)but-2-enoate |
|---|---|
| PubChem CID | 77120127 |
| Molecular Formula | C11H12N4O3 |
| Molecular Weight | 248.24 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | methyl 2-methyl-4-(3-oxo-[1,2,4]triazolo[4,3-a]pyrazin-2-yl)but-2-enoate |
| SMILES | COC(=O)C(C)=CCn1nc2cnccn2c1=O |
| InChI | InChI=1S/C11H12N4O3/c1-8(10(16)18-2)3-5-15-11(17)14-6-4-12-7-9(14)13-15/h3-4,6-7H,5H2,1-2H3 |
| InChIKey | PDHGCEMTQXYTHE-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 78.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.24 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|